40% off

Early-bird ends 15 Aug, 9am

Lock in £90

Solving Trigonometric Equations for the TMUA

Updated August 2025

Master the techniques for solving trigonometric equations within specific intervals for the TMUA. This page covers using principal values to find multiple solutions, handling compound angles correctly, and solving quadratic equations involving trigonometric identities such as sin2θ+cos2θ=1\sin^2 \theta + \cos^2 \theta = 1.

Core concept

Trigonometric equations are solved by finding a principal solution using an inverse function and then applying the periodic and symmetrical properties of the graph (or a CAST diagram) to locate all other solutions within the required interval.

Solving trigonometric equations requires a systematic approach to ensure no solutions are missed within the specified range. The TMUA expects you to be comfortable using both graphical and CAST type methods to list the full set of solutions for a given interval.

The Order of Operations in Solving Equations

When solving equations of the form sin(ax+b)=k\sin(ax + b) = k, it is critical to find the full set of solutions for the compound angle before performing any algebraic rearrangement to find xx. A common error is to rearrange the basic solution first and then attempt to find other values, which frequently leads to missing solutions.

Worked Example: Handling Compound Angles

Question: Solve sin2(2x+60)=14\sin^2(2x + 60) = \frac{1}{4} for 360<x<360-360 < x < 360

Step 1: Take the square root. We must consider both the positive and negative square roots. This gives us two equations to solve: sin(2x+60)=12\sin(2x + 60) = \frac{1}{2} and sin(2x+60)=12\sin(2x + 60) = -\frac{1}{2}

Step 2: Find the basic solution. For sin(2x+60)=12\sin(2x + 60) = \frac{1}{2}, the basic solution (the one a calculator gives) is 3030^\circ.

Step 3: List solutions for the compound angle. Because we will eventually divide by 2 and subtract 60 to find xx, we must look at a range for 2x+602x + 60 that extends beyond the target range of 360<x<360-360 < x < 360. We list all relevant solutions for 2x+602x + 60 based on the symmetry of the sine graph:

img-45.jpeg

From the symmetry of the graph (or CAST diagram), we find: 2x+60=,690,570,330,210,30,150,390,510,750,870,2x + 60 = \dots, -690, -570, -330, -210, 30, 150, 390, 510, 750, 870, \dots

Step 4: Solve for x. Now we subtract 60 from each and divide by 2: x=,375,315,195,135,15,45,165,225,345,405,x = \dots, -375, -315, -195, -135, -15, 45, 165, 225, 345, 405, \dots

Step 5: Filter by the interval. We select only those values in the range 360<x<360-360 < x < 360: x=315,195,135,15,45,165,225,345x = -315, -195, -135, -15, 45, 165, 225, 345

Avoiding the Rearrangement Error

If you rearrange the basic solution before finding the general solutions, you will lose roots. For example, starting with 2x+60=302x + 60 = 30 and rearranging to x=15x = -15, then trying to find other xx values by adding periods of the sine graph, results in a significantly reduced set of solutions (x=165,15,195,345x = -165, -15, 195, 345). The following diagram illustrates why this method is incorrect:

img-46.jpeg

Using Trigonometric Identities to Solve Quadratics

Trigonometry is often mixed with quadratics. To solve these, you must use identities to ensure the entire equation is in terms of a single trigonometric function, such as sinx\sin x or cosx\cos x.

Identity 1: tanθ=sinθcosθ\tan \theta = \frac{\sin \theta}{\cos \theta} Identity 2: sin2θ+cos2θ=1\sin^2 \theta + \cos^2 \theta = 1

Worked Example: Quadratic Trig Equation

Question: Solve 12cos2x+6sinx10=212 \cos^2 x + 6 \sin x - 10 = 2 for 0<x<3600^\circ < x < 360^\circ.

Step 1: Use the Pythagorean identity. Since the equation has a sinx\sin x term, we convert the cos2x\cos^2 x term using cos2x=1sin2x\cos^2 x = 1 - \sin^2 x: 12(1sin2x)+6sinx10=212(1 - \sin^2 x) + 6 \sin x - 10 = 2

Step 2: Simplify to a standard quadratic. Let S=sinxS = \sin x to make the algebra clearer: 1212S2+6S10=212 - 12S^2 + 6S - 10 = 2 12S2+6S=0-12S^2 + 6S = 0 12S26S=012S^2 - 6S = 0

Step 3: Factorise and solve for S: 6S(2S1)=06S(2S - 1) = 0 This gives S=0S = 0 or S=12S = \frac{1}{2}.

Step 4: Solve for x: If sinx=0\sin x = 0, then x=180x = 180^\circ (within the open interval 0<x<3600 < x < 360). If sinx=12\sin x = \frac{1}{2}, then x=30x = 30^\circ or x=150x = 150^\circ.

Final solutions: x=30,150,180x = 30, 150, 180.

Key takeaways

  • Always consider both the positive and negative square roots (±\pm) when solving an equation involving squared trigonometric functions.
  • For compound angles like sin(2x+60)\sin(2x+60), find all possible values for the entire bracket before rearranging for xx.
  • The identity sin2θ+cos2θ=1\sin^2 \theta + \cos^2 \theta = 1 is essential for converting equations into a single trigonometric function, allowing them to be solved as quadratics.
  • Be precise with the interval: check whether the boundaries are included (\leq) or excluded (<<).
Tips

When solving tanx=k\tan x = k, remember that the tangent function has a period of 180180^\circ (π\pi radians) and no symmetry within that period like sine or cosine. You can simply find the principal value and add or subtract multiples of 180180^\circ (π\pi) to find all other solutions.

Cautions

Do not divide both sides of an equation by a trigonometric function like sinx\sin x, as you may lose valid solutions where sinx=0\sin x = 0. Instead, factorise the expression.

Insight

The relationship between roots and factors remains true for trigonometry. If sinx=k\sin x = k is a solution, then (sinxk)(\sin x - k) is a factor of the trigonometric expression. This is why we treat trig quadratics just like algebraic ones.

Worked Examples

Example 1
kk is the smallest positive value of xx which is a solution to both the equations 2sinx+1=02\sin x + 1 = 0 and 2cos2x=12\cos 2x = 1.

How many values of
xx in the range 0xk0 \leq x \leq k are solutions to at least one of these equations?
A:0
B:2
C:3
D:4
E:8

Practice Questions

Practice Question 1
Find the maximum angle xx in the range 0x3600^\circ \leq x \leq 360^\circ which satisfies the equation

cos2(2x)+3sin(2x)74=0\cos^2(2x) + \sqrt{3}\sin(2x) - \frac{7}{4} = 0
A:3030^\circ
B:6060^\circ
C:120120^\circ
D:150150^\circ
E:210210^\circ
F:240240^\circ
G:300300^\circ
H:330330^\circ

Frequently asked questions

How do I know if I have found all the solutions in the interval?

Use the periodic nature of the function. For sinx\sin x and cosx\cos x, the period is 360360^\circ (2π2\pi radians). For tanx\tan x, it is 180180^\circ (π\pi radians). Always sketch the graph or use a CAST diagram to check for reflections (e.g., 180θ180 - \theta for sine) within the expanded range of a compound angle.

Should I use the graph method or the CAST diagram?

Both are valid and should yield the same results. The graph method is often more intuitive for visualizing the total number of solutions, while the CAST diagram is very efficient for finding the related angles in different quadrants. The TMUA guide recommends being comfortable with both.

Why does sin2x+cos2x=1\sin^2 x + \cos^2 x = 1 work for any angle?

This identity is a direct consequence of Pythagoras' Theorem applied to a right-angled triangle with a hypotenuse of 1. It holds for all real angles, as shown by the unit circle definition of sine and cosine.

Ready to test your knowledge?

You've reached the end of this section. Start a practice session to solidify your understanding and master this topic.